C30H31FN4O4S — CID 74221973
3-[(1R)-1-[2-[2-[(1S,2S)-2-aminocyclohexyl]ethynyl]-3-methylphenyl]ethyl]-N-(6-fluoro-2-pyridinyl)-5-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 74221973) has the molecular formula C30H31FN4O4S and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-[(1R)-1-[2-[2-[(1S,2S)-2-aminocyclohexyl]ethynyl]-3-methylphenyl]ethyl]-N-(6-fluoro-2-pyridinyl)-5-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-[(1R)-1-[2-[2-[(1S,2S)-2-aminocyclohexyl]ethynyl]-3-methylphenyl]ethyl]-N-(6-fluoro-2-pyridinyl)-5-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 74221973 |
| Molecular Formula | C30H31FN4O4S |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 3-[(1R)-1-[2-[2-[(1S,2S)-2-aminocyclohexyl]ethynyl]-3-methylphenyl]ethyl]-N-(6-fluoro-2-pyridinyl)-5-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)Nc1cccc(F)n1)oc(=O)n2[C@H](C)c1cccc(C)c1C#C[C@@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C30H31FN4O4S/c1-18-8-6-10-23(22(18)15-14-21-9-4-5-11-24(21)32)20(3)35-25-16-19(2)27(17-26(25)39-30(35)36)40(37,38)34-29-13-7-12-28(31)33-29/h6-8,10,12-13,16-17,20-21,24H,4-5,9,11,32H2,1-3H3,(H,33,34)/t20-,21+,24+/m1/s1 |
| InChIKey | VPWNFHCWXRGVCB-DPLHUUCSSA-N |
| XLogP | 5.02 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|