C26H30N4O5 — CID 74222499
(19S)-10,19-diethyl-7,19-dihydroxy-6,8-bis(methylaminomethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 74222499) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is (19S)-10,19-diethyl-7,19-dihydroxy-6,8-bis(methylaminomethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-10,19-diethyl-7,19-dihydroxy-6,8-bis(methylaminomethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 74222499 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (19S)-10,19-diethyl-7,19-dihydroxy-6,8-bis(methylaminomethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCc1c2c(nc3cc(CNC)c(O)c(CNC)c13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C26H30N4O5/c1-5-14-16-11-30-20(8-18-17(24(30)32)12-35-25(33)26(18,34)6-2)22(16)29-19-7-13(9-27-3)23(31)15(10-28-4)21(14)19/h7-8,27-28,31,34H,5-6,9-12H2,1-4H3/t26-/m0/s1 |
| InChIKey | MUZNJDGTZWLLDY-SANMLTNESA-N |
| XLogP | 1.79 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|