C28H34N4O5 — CID 74222501
(19S)-6,8-bis[(dimethylamino)methyl]-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 74222501) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is (19S)-6,8-bis[(dimethylamino)methyl]-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-6,8-bis[(dimethylamino)methyl]-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 74222501 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (19S)-6,8-bis[(dimethylamino)methyl]-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCc1c2c(nc3cc(CN(C)C)c(O)c(CN(C)C)c13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C28H34N4O5/c1-7-16-17-13-32-22(10-20-19(26(32)34)14-37-27(35)28(20,36)8-2)24(17)29-21-9-15(11-30(3)4)25(33)18(23(16)21)12-31(5)6/h9-10,33,36H,7-8,11-14H2,1-6H3/t28-/m0/s1 |
| InChIKey | GXSMMTYPBHTJGM-NDEPHWFRSA-N |
| XLogP | 2.47 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|