C20H20N2O2S — CID 74227128
2-(1-methylindol-3-yl)-3-(2-phenoxyethyl)-1,3-thiazolidin-4-one (PubChem CID 74227128) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-3-(2-phenoxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-methylindol-3-yl)-3-(2-phenoxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 74227128 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-(1-methylindol-3-yl)-3-(2-phenoxyethyl)-1,3-thiazolidin-4-one |
| SMILES | Cn1cc(C2SCC(=O)N2CCOc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O2S/c1-21-13-17(16-9-5-6-10-18(16)21)20-22(19(23)14-25-20)11-12-24-15-7-3-2-4-8-15/h2-10,13,20H,11-12,14H2,1H3 |
| InChIKey | YYDNTUAYXROICX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |