C22H25FN2O — CID 74227684
N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-5-hex-1-ynylpyridine-3-carboxamide (PubChem CID 74227684) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-5-hex-1-ynylpyridine-3-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-5-hex-1-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 74227684 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-5-hex-1-ynylpyridine-3-carboxamide |
| SMILES | CCCCC#Cc1cncc(C(=O)NC(C)(C)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H25FN2O/c1-4-5-6-7-8-18-13-19(16-24-15-18)21(26)25-22(2,3)14-17-9-11-20(23)12-10-17/h9-13,15-16H,4-6,14H2,1-3H3,(H,25,26) |
| InChIKey | MZMAXQZHMQTTQI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|