C19H21N3O3S — CID 5006622
ethyl 2-[2-[(5-hex-1-ynylpyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 5006622) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 2-[2-[(5-hex-1-ynylpyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(5-hex-1-ynylpyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 5006622 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | ethyl 2-[2-[(5-hex-1-ynylpyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCCC#Cc1cncc(C(=O)Nc2nc(CC(=O)OCC)cs2)c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-3-5-6-7-8-14-9-15(12-20-11-14)18(24)22-19-21-16(13-26-19)10-17(23)25-4-2/h9,11-13H,3-6,10H2,1-2H3,(H,21,22,24) |
| InChIKey | QXEALWSWLHLYOG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|