C18H29N3O6S — CID 74228058
ethyl (4S)-3-[1-[(4-ethoxy-4-oxobutyl)carbamothioyl]piperidin-4-yl]-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 74228058) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is ethyl (4S)-3-[1-[(4-ethoxy-4-oxobutyl)carbamothioyl]piperidin-4-yl]-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl (4S)-3-[1-[(4-ethoxy-4-oxobutyl)carbamothioyl]piperidin-4-yl]-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 74228058 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | ethyl (4S)-3-[1-[(4-ethoxy-4-oxobutyl)carbamothioyl]piperidin-4-yl]-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)CCCNC(=S)N1CCC(N2C(=O)OC[C@H]2C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H29N3O6S/c1-3-25-15(22)6-5-9-19-17(28)20-10-7-13(8-11-20)21-14(12-27-18(21)24)16(23)26-4-2/h13-14H,3-12H2,1-2H3,(H,19,28)/t14-/m0/s1 |
| InChIKey | OOTJFAINKKGEEC-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|