C14H13N5O3S — CID 74233190
N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide (PubChem CID 74233190) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide.
| Compound Name | N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 74233190 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide |
| SMILES | O=C(NCc1noc(-c2cccs2)n1)c1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C14H13N5O3S/c20-13(12-8-7-21-4-3-9(8)17-18-12)15-6-11-16-14(22-19-11)10-2-1-5-23-10/h1-2,5H,3-4,6-7H2,(H,15,20)(H,17,18) |
| InChIKey | YFLBJNSTVAYQLA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |