C14H17N5O — CID 74233718
N-[(3R)-piperidin-3-yl]-2-(1,2,4-triazol-4-yl)benzamide (PubChem CID 74233718) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[(3R)-piperidin-3-yl]-2-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | N-[(3R)-piperidin-3-yl]-2-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 74233718 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[(3R)-piperidin-3-yl]-2-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1ccccc1-n1cnnc1 |
| InChI | InChI=1S/C14H17N5O/c20-14(18-11-4-3-7-15-8-11)12-5-1-2-6-13(12)19-9-16-17-10-19/h1-2,5-6,9-11,15H,3-4,7-8H2,(H,18,20)/t11-/m1/s1 |
| InChIKey | BTWKANQOZDXXNG-LLVKDONJSA-N |
| XLogP | 0.75 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |