C18H22N4O2S — CID 74234179
2-(3-oxo-1H-isoindol-2-yl)-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]butanamide (PubChem CID 74234179) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(3-oxo-1H-isoindol-2-yl)-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]butanamide.
| Compound Name | 2-(3-oxo-1H-isoindol-2-yl)-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 74234179 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(3-oxo-1H-isoindol-2-yl)-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]butanamide |
| SMILES | CCC(C(=O)NCc1snnc1C(C)C)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H22N4O2S/c1-4-14(22-10-12-7-5-6-8-13(12)18(22)24)17(23)19-9-15-16(11(2)3)20-21-25-15/h5-8,11,14H,4,9-10H2,1-3H3,(H,19,23) |
| InChIKey | WJEPKKMPQRTFNI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |