C13H14N4OS — CID 74234300
thiomorpholin-4-yl-[2-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 74234300) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is thiomorpholin-4-yl-[2-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | thiomorpholin-4-yl-[2-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 74234300 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | thiomorpholin-4-yl-[2-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | O=C(c1ccccc1-n1cnnc1)N1CCSCC1 |
| InChI | InChI=1S/C13H14N4OS/c18-13(16-5-7-19-8-6-16)11-3-1-2-4-12(11)17-9-14-15-10-17/h1-4,9-10H,5-8H2 |
| InChIKey | NVPFXYCQKBSUOJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |