C20H26N4OS — CID 74234499
N-cyclohexyl-N-(2-ethylsulfanylethyl)-2-pyridin-3-ylpyrimidine-5-carboxamide (PubChem CID 74234499) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is N-cyclohexyl-N-(2-ethylsulfanylethyl)-2-pyridin-3-ylpyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-N-(2-ethylsulfanylethyl)-2-pyridin-3-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74234499 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-cyclohexyl-N-(2-ethylsulfanylethyl)-2-pyridin-3-ylpyrimidine-5-carboxamide |
| SMILES | CCSCCN(C(=O)c1cnc(-c2cccnc2)nc1)C1CCCCC1 |
| InChI | InChI=1S/C20H26N4OS/c1-2-26-12-11-24(18-8-4-3-5-9-18)20(25)17-14-22-19(23-15-17)16-7-6-10-21-13-16/h6-7,10,13-15,18H,2-5,8-9,11-12H2,1H3 |
| InChIKey | UYWCVWPOSYIGDF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|