C22H33N3O3S — CID 21340887
3-[2-[acetyl(cyclohexyl)amino]ethylsulfanylmethyl]-N,N-dimethyl-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 21340887) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-[2-[acetyl(cyclohexyl)amino]ethylsulfanylmethyl]-N,N-dimethyl-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | 3-[2-[acetyl(cyclohexyl)amino]ethylsulfanylmethyl]-N,N-dimethyl-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 21340887 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-[2-[acetyl(cyclohexyl)amino]ethylsulfanylmethyl]-N,N-dimethyl-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | CC(=O)N(CCSCC(CC(=O)N(C)C)C(=O)c1cccnc1)C1CCCCC1 |
| InChI | InChI=1S/C22H33N3O3S/c1-17(26)25(20-9-5-4-6-10-20)12-13-29-16-19(14-21(27)24(2)3)22(28)18-8-7-11-23-15-18/h7-8,11,15,19-20H,4-6,9-10,12-14,16H2,1-3H3 |
| InChIKey | CSCBVCNIFHUYLH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|