C19H21N3O4S — CID 10271552
4-oxo-3-[2-(phenylcarbamoylamino)ethylsulfanylmethyl]-4-pyridin-3-ylbutanoic acid (PubChem CID 10271552) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-oxo-3-[2-(phenylcarbamoylamino)ethylsulfanylmethyl]-4-pyridin-3-ylbutanoic acid.
| Compound Name | 4-oxo-3-[2-(phenylcarbamoylamino)ethylsulfanylmethyl]-4-pyridin-3-ylbutanoic acid |
|---|---|
| PubChem CID | 10271552 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-oxo-3-[2-(phenylcarbamoylamino)ethylsulfanylmethyl]-4-pyridin-3-ylbutanoic acid |
| SMILES | O=C(O)CC(CSCCNC(=O)Nc1ccccc1)C(=O)c1cccnc1 |
| InChI | InChI=1S/C19H21N3O4S/c23-17(24)11-15(18(25)14-5-4-8-20-12-14)13-27-10-9-21-19(26)22-16-6-2-1-3-7-16/h1-8,12,15H,9-11,13H2,(H,23,24)(H2,21,22,26) |
| InChIKey | MURWBIOLGOYNGX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|