C24H28FN3O3S — CID 21340905
4-fluoro-N-[2-[4-oxo-4-piperidin-1-yl-2-(pyridine-3-carbonyl)butyl]sulfanylethyl]benzamide (PubChem CID 21340905) has the molecular formula C24H28FN3O3S and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-oxo-4-piperidin-1-yl-2-(pyridine-3-carbonyl)butyl]sulfanylethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-oxo-4-piperidin-1-yl-2-(pyridine-3-carbonyl)butyl]sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 21340905 |
| Molecular Formula | C24H28FN3O3S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-fluoro-N-[2-[4-oxo-4-piperidin-1-yl-2-(pyridine-3-carbonyl)butyl]sulfanylethyl]benzamide |
| SMILES | O=C(NCCSCC(CC(=O)N1CCCCC1)C(=O)c1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN3O3S/c25-21-8-6-18(7-9-21)24(31)27-11-14-32-17-20(23(30)19-5-4-10-26-16-19)15-22(29)28-12-2-1-3-13-28/h4-10,16,20H,1-3,11-15,17H2,(H,27,31) |
| InChIKey | ALUYRYSTSOABOC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|