C17H24N4O — CID 74234942
1-(4-butan-2-ylphenyl)-3-[3-(1H-imidazol-2-yl)propyl]urea (PubChem CID 74234942) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-3-[3-(1H-imidazol-2-yl)propyl]urea.
| Compound Name | 1-(4-butan-2-ylphenyl)-3-[3-(1H-imidazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 74234942 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-3-[3-(1H-imidazol-2-yl)propyl]urea |
| SMILES | CCC(C)c1ccc(NC(=O)NCCCc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C17H24N4O/c1-3-13(2)14-6-8-15(9-7-14)21-17(22)20-10-4-5-16-18-11-12-19-16/h6-9,11-13H,3-5,10H2,1-2H3,(H,18,19)(H2,20,21,22) |
| InChIKey | WKRCFGFTPZKTKY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|