C18H20ClN3O3 — CID 74235089
N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide (PubChem CID 74235089) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 74235089 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[2-[(2-chlorobenzoyl)amino]ethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide |
| SMILES | CC(C)c1ccc(C(=O)NCCNC(=O)c2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-11(2)15-8-7-13(18(25)22-15)17(24)21-10-9-20-16(23)12-5-3-4-6-14(12)19/h3-8,11H,9-10H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | BNJJJMKXAWEPFA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|