C17H22ClFN2O2 — CID 74235574
[4-(3-chloro-4-fluorophenyl)piperazin-1-yl]-[1-(methoxymethyl)cyclobutyl]methanone (PubChem CID 74235574) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is [4-(3-chloro-4-fluorophenyl)piperazin-1-yl]-[1-(methoxymethyl)cyclobutyl]methanone.
| Compound Name | [4-(3-chloro-4-fluorophenyl)piperazin-1-yl]-[1-(methoxymethyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 74235574 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [4-(3-chloro-4-fluorophenyl)piperazin-1-yl]-[1-(methoxymethyl)cyclobutyl]methanone |
| SMILES | COCC1(C(=O)N2CCN(c3ccc(F)c(Cl)c3)CC2)CCC1 |
| InChI | InChI=1S/C17H22ClFN2O2/c1-23-12-17(5-2-6-17)16(22)21-9-7-20(8-10-21)13-3-4-15(19)14(18)11-13/h3-4,11H,2,5-10,12H2,1H3 |
| InChIKey | BJFOVOLMWFNTGL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |