C17H23N3O5S — CID 74235590
1-(3-hydroxyphenyl)-5-oxo-N-(2-pyrrolidin-1-ylsulfonylethyl)pyrrolidine-3-carboxamide (PubChem CID 74235590) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-5-oxo-N-(2-pyrrolidin-1-ylsulfonylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-hydroxyphenyl)-5-oxo-N-(2-pyrrolidin-1-ylsulfonylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 74235590 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-(3-hydroxyphenyl)-5-oxo-N-(2-pyrrolidin-1-ylsulfonylethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCCC1)C1CC(=O)N(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C17H23N3O5S/c21-15-5-3-4-14(11-15)20-12-13(10-16(20)22)17(23)18-6-9-26(24,25)19-7-1-2-8-19/h3-5,11,13,21H,1-2,6-10,12H2,(H,18,23) |
| InChIKey | CBZFMVPXYMAXDZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |