C13H14F3NO3 — CID 74236468
N-[[3-(trifluoromethoxy)phenyl]methyl]oxolane-3-carboxamide (PubChem CID 74236468) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[[3-(trifluoromethoxy)phenyl]methyl]oxolane-3-carboxamide.
| Compound Name | N-[[3-(trifluoromethoxy)phenyl]methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 74236468 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[[3-(trifluoromethoxy)phenyl]methyl]oxolane-3-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)C1CCOC1 |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)20-11-3-1-2-9(6-11)7-17-12(18)10-4-5-19-8-10/h1-3,6,10H,4-5,7-8H2,(H,17,18) |
| InChIKey | JRPPBDCJMKXMFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |