C14H18F3NO2 — CID 103643870
1-(oxan-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]methanamine (PubChem CID 103643870) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(oxan-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]methanamine.
| Compound Name | 1-(oxan-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 103643870 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(oxan-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]methanamine |
| SMILES | FC(F)(F)Oc1cccc(CNCC2CCCOC2)c1 |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)20-13-5-1-3-11(7-13)8-18-9-12-4-2-6-19-10-12/h1,3,5,7,12,18H,2,4,6,8-10H2 |
| InChIKey | WQOHMHQXBFNNQX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |