C13H16F3NO — CID 55147927
1-(oxan-3-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine (PubChem CID 55147927) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-(oxan-3-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine.
| Compound Name | 1-(oxan-3-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 55147927 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(oxan-3-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
| SMILES | Fc1cc(CNCC2CCCOC2)cc(F)c1F |
| InChI | InChI=1S/C13H16F3NO/c14-11-4-10(5-12(15)13(11)16)7-17-6-9-2-1-3-18-8-9/h4-5,9,17H,1-3,6-8H2 |
| InChIKey | MPYYFENQCHKZJL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|