C13H16F3N — CID 115690076
2-cyclobutyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 115690076) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-cyclobutyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | 2-cyclobutyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115690076 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-cyclobutyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | Fc1cc(CNCCC2CCC2)cc(F)c1F |
| InChI | InChI=1S/C13H16F3N/c14-11-6-10(7-12(15)13(11)16)8-17-5-4-9-2-1-3-9/h6-7,9,17H,1-5,8H2 |
| InChIKey | KQWVATGEFZDEKM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|