C20H19N3O2 — CID 74236477
N-[cyclopropyl-(4-methyl-2-pyridinyl)methyl]-1-oxo-2H-isoquinoline-4-carboxamide (PubChem CID 74236477) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methyl-2-pyridinyl)methyl]-1-oxo-2H-isoquinoline-4-carboxamide.
| Compound Name | N-[cyclopropyl-(4-methyl-2-pyridinyl)methyl]-1-oxo-2H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 74236477 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[cyclopropyl-(4-methyl-2-pyridinyl)methyl]-1-oxo-2H-isoquinoline-4-carboxamide |
| SMILES | Cc1ccnc(C(NC(=O)c2c[nH]c(=O)c3ccccc23)C2CC2)c1 |
| InChI | InChI=1S/C20H19N3O2/c1-12-8-9-21-17(10-12)18(13-6-7-13)23-20(25)16-11-22-19(24)15-5-3-2-4-14(15)16/h2-5,8-11,13,18H,6-7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | HYSGMPRYSJUQIP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |