C21H20N2O3 — CID 74236865
3-benzyl-4-(2-methyl-1-benzofuran-7-carbonyl)piperazin-2-one (PubChem CID 74236865) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-benzyl-4-(2-methyl-1-benzofuran-7-carbonyl)piperazin-2-one.
| Compound Name | 3-benzyl-4-(2-methyl-1-benzofuran-7-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 74236865 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-benzyl-4-(2-methyl-1-benzofuran-7-carbonyl)piperazin-2-one |
| SMILES | Cc1cc2cccc(C(=O)N3CCNC(=O)C3Cc3ccccc3)c2o1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-12-16-8-5-9-17(19(16)26-14)21(25)23-11-10-22-20(24)18(23)13-15-6-3-2-4-7-15/h2-9,12,18H,10-11,13H2,1H3,(H,22,24) |
| InChIKey | LGSZHVCGNGAWSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |