C23H26N2O3 — CID 138004597
3-benzyl-4-(2,2-dimethyl-3H-1-benzofuran-7-carbonyl)-1,4-diazepan-2-one (PubChem CID 138004597) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-benzyl-4-(2,2-dimethyl-3H-1-benzofuran-7-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 3-benzyl-4-(2,2-dimethyl-3H-1-benzofuran-7-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 138004597 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-benzyl-4-(2,2-dimethyl-3H-1-benzofuran-7-carbonyl)-1,4-diazepan-2-one |
| SMILES | CC1(C)Cc2cccc(C(=O)N3CCCNC(=O)C3Cc3ccccc3)c2O1 |
| InChI | InChI=1S/C23H26N2O3/c1-23(2)15-17-10-6-11-18(20(17)28-23)22(27)25-13-7-12-24-21(26)19(25)14-16-8-4-3-5-9-16/h3-6,8-11,19H,7,12-15H2,1-2H3,(H,24,26) |
| InChIKey | UFHYSDVRYHZVLR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |