C20H33N3OS — CID 74237404
[3-(3-methylsulfanylpropyl)-9-(pyridin-3-ylmethyl)-3,9-diazaspiro[5.5]undecan-5-yl]methanol (PubChem CID 74237404) has the molecular formula C20H33N3OS and a molecular weight of 363.57 g/mol. Its IUPAC name is [3-(3-methylsulfanylpropyl)-9-(pyridin-3-ylmethyl)-3,9-diazaspiro[5.5]undecan-5-yl]methanol.
| Compound Name | [3-(3-methylsulfanylpropyl)-9-(pyridin-3-ylmethyl)-3,9-diazaspiro[5.5]undecan-5-yl]methanol |
|---|---|
| PubChem CID | 74237404 |
| Molecular Formula | C20H33N3OS |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [3-(3-methylsulfanylpropyl)-9-(pyridin-3-ylmethyl)-3,9-diazaspiro[5.5]undecan-5-yl]methanol |
| SMILES | CSCCCN1CCC2(CCN(Cc3cccnc3)CC2)C(CO)C1 |
| InChI | InChI=1S/C20H33N3OS/c1-25-13-3-9-22-10-5-20(19(16-22)17-24)6-11-23(12-7-20)15-18-4-2-8-21-14-18/h2,4,8,14,19,24H,3,5-7,9-13,15-17H2,1H3 |
| InChIKey | KEKJKXZQKHFLGU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|