C14H21N3O3 — CID 74239871
1-methyl-N-(3-morpholin-4-ylpropyl)-6-oxopyridine-3-carboxamide (PubChem CID 74239871) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-methyl-N-(3-morpholin-4-ylpropyl)-6-oxopyridine-3-carboxamide.
| Compound Name | 1-methyl-N-(3-morpholin-4-ylpropyl)-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 74239871 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-methyl-N-(3-morpholin-4-ylpropyl)-6-oxopyridine-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCCCN2CCOCC2)ccc1=O |
| InChI | InChI=1S/C14H21N3O3/c1-16-11-12(3-4-13(16)18)14(19)15-5-2-6-17-7-9-20-10-8-17/h3-4,11H,2,5-10H2,1H3,(H,15,19) |
| InChIKey | SOGKBIBVCVTAMJ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|