C17H19ClN4O3S — CID 7424016
N-[2-(4-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-[(2S)-1-hydroxybutan-2-yl]oxamide (PubChem CID 7424016) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-[(2S)-1-hydroxybutan-2-yl]oxamide.
| Compound Name | N-[2-(4-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-[(2S)-1-hydroxybutan-2-yl]oxamide |
|---|---|
| PubChem CID | 7424016 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N'-[(2S)-1-hydroxybutan-2-yl]oxamide |
| SMILES | CC[C@@H](CO)NC(=O)C(=O)Nc1c2c(nn1-c1ccc(Cl)cc1)CSC2 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-2-11(7-23)19-16(24)17(25)20-15-13-8-26-9-14(13)21-22(15)12-5-3-10(18)4-6-12/h3-6,11,23H,2,7-9H2,1H3,(H,19,24)(H,20,25)/t11-/m0/s1 |
| InChIKey | XGEUFYVFNMBJLD-NSHDSACASA-N |
| XLogP | 2.10 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|