C17H20N4O3S — CID 7676251
N-[(2S)-2-hydroxypropyl]-N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]oxamide (PubChem CID 7676251) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]oxamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 7676251 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]oxamide |
| SMILES | Cc1ccc(-n2nc3c(c2NC(=O)C(=O)NC[C@H](C)O)CSC3)cc1 |
| InChI | InChI=1S/C17H20N4O3S/c1-10-3-5-12(6-4-10)21-15(13-8-25-9-14(13)20-21)19-17(24)16(23)18-7-11(2)22/h3-6,11,22H,7-9H2,1-2H3,(H,18,23)(H,19,24)/t11-/m0/s1 |
| InChIKey | BBXMSBWQXWCBDH-NSHDSACASA-N |
| XLogP | 1.36 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|