C20H25N5O3S — CID 7676279
N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 7676279) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 7676279 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N'-[2-(4-methylphenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-yl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | Cc1ccc(-n2nc3c(c2NC(=O)C(=O)NCCN2CCOCC2)CSC3)cc1 |
| InChI | InChI=1S/C20H25N5O3S/c1-14-2-4-15(5-3-14)25-18(16-12-29-13-17(16)23-25)22-20(27)19(26)21-6-7-24-8-10-28-11-9-24/h2-5H,6-13H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | HUQKMPVTVVBMSL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|