C18H25N5O3 — CID 74241065
1-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-3-(3-pyrrolidin-1-ylpropyl)urea (PubChem CID 74241065) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-3-(3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-3-(3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 74241065 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[3-(3-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-3-(3-pyrrolidin-1-ylpropyl)urea |
| SMILES | CN1CC(=O)N(c2cccc(NC(=O)NCCCN3CCCC3)c2)C1=O |
| InChI | InChI=1S/C18H25N5O3/c1-21-13-16(24)23(18(21)26)15-7-4-6-14(12-15)20-17(25)19-8-5-11-22-9-2-3-10-22/h4,6-7,12H,2-3,5,8-11,13H2,1H3,(H2,19,20,25) |
| InChIKey | NYSQJJXRJMNOIT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|