C16H22FN3O4 — CID 74241945
2-fluoro-5-[[[4-(hydroxymethyl)oxan-4-yl]methyl-methylcarbamoyl]amino]benzamide (PubChem CID 74241945) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-fluoro-5-[[[4-(hydroxymethyl)oxan-4-yl]methyl-methylcarbamoyl]amino]benzamide.
| Compound Name | 2-fluoro-5-[[[4-(hydroxymethyl)oxan-4-yl]methyl-methylcarbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 74241945 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-fluoro-5-[[[4-(hydroxymethyl)oxan-4-yl]methyl-methylcarbamoyl]amino]benzamide |
| SMILES | CN(CC1(CO)CCOCC1)C(=O)Nc1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C16H22FN3O4/c1-20(9-16(10-21)4-6-24-7-5-16)15(23)19-11-2-3-13(17)12(8-11)14(18)22/h2-3,8,21H,4-7,9-10H2,1H3,(H2,18,22)(H,19,23) |
| InChIKey | AGFJEPOPAYDLLZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |