About 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide
6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide (PubChem CID 74243181) has the molecular formula C12H15N3O3S
and a molecular weight of 281.34 g/mol. Its IUPAC name is 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide |
| PubChem CID | 74243181 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)NC2C=CS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C12H15N3O3S/c1-15(2)11-4-3-9(7-13-11)12(16)14-10-5-6-19(17,18)8-10/h3-7,10H,8H2,1-2H3,(H,14,16) |
| InChIKey | OGCJTROPOZRXIO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide?
The IUPAC name of 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide (CID 74243181) is 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide.
What is the SMILES notation for 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide?
The canonical SMILES for 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide is CN(C)c1ccc(C(=O)NC2C=CS(=O)(=O)C2)cn1.
What is the InChIKey of 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide?
The InChIKey is OGCJTROPOZRXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3S/c1-15(2)11-4-3-9(7-13-11)12(16)14-10-5-6-19(17,18)8-10/h3-7,10H,8H2,1-2H3,(H,14,16).
What are the key properties of 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide?
6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide has a molecular weight of 281.34 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridine-3-carboxamide is sourced from PubChem (CID 74243181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).