C21H19N5O2 — CID 74243480
N-[2-(2-methylquinolin-8-yl)oxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 74243480) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[2-(2-methylquinolin-8-yl)oxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-[2-(2-methylquinolin-8-yl)oxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 74243480 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-(2-methylquinolin-8-yl)oxyethyl]-2-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | Cc1ccc2cccc(OCCNC(=O)c3ccccc3-c3ncn[nH]3)c2n1 |
| InChI | InChI=1S/C21H19N5O2/c1-14-9-10-15-5-4-8-18(19(15)25-14)28-12-11-22-21(27)17-7-3-2-6-16(17)20-23-13-24-26-20/h2-10,13H,11-12H2,1H3,(H,22,27)(H,23,24,26) |
| InChIKey | ZMINCGYIPGTYEQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|