C19H24N4O2S — CID 74245601
3-(piperidine-1-carbonyl)-N-propyl-N-(thiophen-3-ylmethyl)pyrazine-2-carboxamide (PubChem CID 74245601) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-(piperidine-1-carbonyl)-N-propyl-N-(thiophen-3-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | 3-(piperidine-1-carbonyl)-N-propyl-N-(thiophen-3-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 74245601 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-(piperidine-1-carbonyl)-N-propyl-N-(thiophen-3-ylmethyl)pyrazine-2-carboxamide |
| SMILES | CCCN(Cc1ccsc1)C(=O)c1nccnc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H24N4O2S/c1-2-9-23(13-15-6-12-26-14-15)19(25)17-16(20-7-8-21-17)18(24)22-10-4-3-5-11-22/h6-8,12,14H,2-5,9-11,13H2,1H3 |
| InChIKey | QHCBGAXPFQPTIV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |