C21H28N2O4 — CID 74247687
N,N-bis(furan-2-ylmethyl)-1-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 74247687) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N,N-bis(furan-2-ylmethyl)-1-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | N,N-bis(furan-2-ylmethyl)-1-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 74247687 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N,N-bis(furan-2-ylmethyl)-1-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(C1CCCN(C2CCOCC2)C1)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C21H28N2O4/c24-21(17-4-1-9-22(14-17)18-7-12-25-13-8-18)23(15-19-5-2-10-26-19)16-20-6-3-11-27-20/h2-3,5-6,10-11,17-18H,1,4,7-9,12-16H2 |
| InChIKey | ZZLRAMZKDIMYKN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |