C19H30N2O3 — CID 95119803
(3S)-1-cyclohexyl-N-(furan-2-ylmethyl)-N-(2-hydroxyethyl)piperidine-3-carboxamide (PubChem CID 95119803) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-N-(furan-2-ylmethyl)-N-(2-hydroxyethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-cyclohexyl-N-(furan-2-ylmethyl)-N-(2-hydroxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95119803 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (3S)-1-cyclohexyl-N-(furan-2-ylmethyl)-N-(2-hydroxyethyl)piperidine-3-carboxamide |
| SMILES | O=C([C@H]1CCCN(C2CCCCC2)C1)N(CCO)Cc1ccco1 |
| InChI | InChI=1S/C19H30N2O3/c22-12-11-21(15-18-9-5-13-24-18)19(23)16-6-4-10-20(14-16)17-7-2-1-3-8-17/h5,9,13,16-17,22H,1-4,6-8,10-12,14-15H2/t16-/m0/s1 |
| InChIKey | QTSDGSYFSLGQBO-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |