C21H25FN4O2 — CID 74249456
N-[2-fluoro-5-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylcarbamoylamino]phenyl]acetamide (PubChem CID 74249456) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[2-fluoro-5-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 74249456 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[2-fluoro-5-[[3-(pyrrolidin-1-ylmethyl)phenyl]methylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC(=O)NCc2cccc(CN3CCCC3)c2)ccc1F |
| InChI | InChI=1S/C21H25FN4O2/c1-15(27)24-20-12-18(7-8-19(20)22)25-21(28)23-13-16-5-4-6-17(11-16)14-26-9-2-3-10-26/h4-8,11-12H,2-3,9-10,13-14H2,1H3,(H,24,27)(H2,23,25,28) |
| InChIKey | BQUPFEKZYZKLPH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |