C17H18FN3O4 — CID 56801848
N-[2-fluoro-5-[(2-hydroxy-3-methoxyphenyl)methylcarbamoylamino]phenyl]acetamide (PubChem CID 56801848) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[2-fluoro-5-[(2-hydroxy-3-methoxyphenyl)methylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-[(2-hydroxy-3-methoxyphenyl)methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 56801848 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[2-fluoro-5-[(2-hydroxy-3-methoxyphenyl)methylcarbamoylamino]phenyl]acetamide |
| SMILES | COc1cccc(CNC(=O)Nc2ccc(F)c(NC(C)=O)c2)c1O |
| InChI | InChI=1S/C17H18FN3O4/c1-10(22)20-14-8-12(6-7-13(14)18)21-17(24)19-9-11-4-3-5-15(25-2)16(11)23/h3-8,23H,9H2,1-2H3,(H,20,22)(H2,19,21,24) |
| InChIKey | NEPFPMKGEVFMSA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|