C19H19FN4 — CID 74249674
8-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-5-fluoroquinoline (PubChem CID 74249674) has the molecular formula C19H19FN4 and a molecular weight of 322.39 g/mol. Its IUPAC name is 8-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-5-fluoroquinoline.
| Compound Name | 8-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-5-fluoroquinoline |
|---|---|
| PubChem CID | 74249674 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 8-(6-ethyl-2-pyrrolidin-1-ylpyrimidin-4-yl)-5-fluoroquinoline |
| SMILES | CCc1cc(-c2ccc(F)c3cccnc23)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H19FN4/c1-2-13-12-17(23-19(22-13)24-10-3-4-11-24)15-7-8-16(20)14-6-5-9-21-18(14)15/h5-9,12H,2-4,10-11H2,1H3 |
| InChIKey | LQNGFHHGWOLDLY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |