C21H24N4O2 — CID 74250324
4-(2-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbonyl)-1-prop-2-enylpyrrolidin-2-one (PubChem CID 74250324) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(2-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbonyl)-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | 4-(2-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbonyl)-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 74250324 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(2-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carbonyl)-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1CC(C(=O)N2CCn3nc(Cc4ccccc4)cc3C2)CC1=O |
| InChI | InChI=1S/C21H24N4O2/c1-2-8-23-14-17(12-20(23)26)21(27)24-9-10-25-19(15-24)13-18(22-25)11-16-6-4-3-5-7-16/h2-7,13,17H,1,8-12,14-15H2 |
| InChIKey | OCVJBOBKLPWERO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|