C16H20N4O4S — CID 74250803
2-(1H-imidazol-2-yl)-N-[(4-methylsulfonylmorpholin-2-yl)methyl]benzamide (PubChem CID 74250803) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-N-[(4-methylsulfonylmorpholin-2-yl)methyl]benzamide.
| Compound Name | 2-(1H-imidazol-2-yl)-N-[(4-methylsulfonylmorpholin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 74250803 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-N-[(4-methylsulfonylmorpholin-2-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCOC(CNC(=O)c2ccccc2-c2ncc[nH]2)C1 |
| InChI | InChI=1S/C16H20N4O4S/c1-25(22,23)20-8-9-24-12(11-20)10-19-16(21)14-5-3-2-4-13(14)15-17-6-7-18-15/h2-7,12H,8-11H2,1H3,(H,17,18)(H,19,21) |
| InChIKey | UJLMDNWBWPDSIO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |