C16H24N4O4S — CID 134709868
[2-[(4-methylsulfonylmorpholin-2-yl)methylamino]-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 134709868) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-[(4-methylsulfonylmorpholin-2-yl)methylamino]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-[(4-methylsulfonylmorpholin-2-yl)methylamino]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 134709868 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [2-[(4-methylsulfonylmorpholin-2-yl)methylamino]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | CS(=O)(=O)N1CCOC(CNc2ncccc2C(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C16H24N4O4S/c1-25(22,23)20-9-10-24-13(12-20)11-18-15-14(5-4-6-17-15)16(21)19-7-2-3-8-19/h4-6,13H,2-3,7-12H2,1H3,(H,17,18) |
| InChIKey | UZWISUWOTMBUFY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |