C22H31N3O2 — CID 74251113
1-[1-[(1-ethylindol-4-yl)methyl]piperidin-4-yl]piperidine-3-carboxylic acid (PubChem CID 74251113) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[1-[(1-ethylindol-4-yl)methyl]piperidin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-[(1-ethylindol-4-yl)methyl]piperidin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 74251113 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-[1-[(1-ethylindol-4-yl)methyl]piperidin-4-yl]piperidine-3-carboxylic acid |
| SMILES | CCn1ccc2c(CN3CCC(N4CCCC(C(=O)O)C4)CC3)cccc21 |
| InChI | InChI=1S/C22H31N3O2/c1-2-24-14-10-20-17(5-3-7-21(20)24)15-23-12-8-19(9-13-23)25-11-4-6-18(16-25)22(26)27/h3,5,7,10,14,18-19H,2,4,6,8-9,11-13,15-16H2,1H3,(H,26,27) |
| InChIKey | VGLRHUZSPRBYCR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |