C24H24FN3O2 — CID 7425758
(4R,7S)-4-(3-fluorophenyl)-2,7-dimethyl-N-(6-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxamide (PubChem CID 7425758) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is (4R,7S)-4-(3-fluorophenyl)-2,7-dimethyl-N-(6-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxamide.
| Compound Name | (4R,7S)-4-(3-fluorophenyl)-2,7-dimethyl-N-(6-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 7425758 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (4R,7S)-4-(3-fluorophenyl)-2,7-dimethyl-N-(6-methyl-2-pyridinyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxamide |
| SMILES | CC1=NC2=C(C(=O)C[C@@H](C)C2)[C@@H](c2cccc(F)c2)C1C(=O)Nc1cccc(C)n1 |
| InChI | InChI=1S/C24H24FN3O2/c1-13-10-18-23(19(29)11-13)22(16-7-5-8-17(25)12-16)21(15(3)27-18)24(30)28-20-9-4-6-14(2)26-20/h4-9,12-13,21-22H,10-11H2,1-3H3,(H,26,28,30)/t13-,21?,22-/m0/s1 |
| InChIKey | HLWJKRGWVIITCZ-KFLFNZDHSA-N |
| XLogP | 4.60 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |