C22H29N3OS — CID 7429352
(5R)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7429352) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is (5R)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7429352 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (5R)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@@H]1CCc2sc(C(=O)N/N=C\c3ccc(N(CC)CC)cc3)cc2C1 |
| InChI | InChI=1S/C22H29N3OS/c1-4-16-9-12-20-18(13-16)14-21(27-20)22(26)24-23-15-17-7-10-19(11-8-17)25(5-2)6-3/h7-8,10-11,14-16H,4-6,9,12-13H2,1-3H3,(H,24,26)/b23-15-/t16-/m1/s1 |
| InChIKey | ZDJPRNOBNUTEEJ-AJIWAEEYSA-N |
| XLogP | 4.87 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|