C16H18N2OS2 — CID 7429271
(5S)-5-ethyl-N-[(Z)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7429271) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is (5S)-5-ethyl-N-[(Z)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-ethyl-N-[(Z)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7429271 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (5S)-5-ethyl-N-[(Z)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@H]1CCc2sc(C(=O)N/N=C\c3cccs3)cc2C1 |
| InChI | InChI=1S/C16H18N2OS2/c1-2-11-5-6-14-12(8-11)9-15(21-14)16(19)18-17-10-13-4-3-7-20-13/h3-4,7,9-11H,2,5-6,8H2,1H3,(H,18,19)/b17-10-/t11-/m0/s1 |
| InChIKey | XTCGEOALXYFBGV-MTUBTWAWSA-N |
| XLogP | 4.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|