C21H24N2OS — CID 7429876
(5S)-N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7429876) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is (5S)-N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7429876 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (5S)-N-[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@H]1CCc2sc(C(=O)N/N=C3/CCCc4ccccc43)cc2C1 |
| InChI | InChI=1S/C21H24N2OS/c1-2-14-10-11-19-16(12-14)13-20(25-19)21(24)23-22-18-9-5-7-15-6-3-4-8-17(15)18/h3-4,6,8,13-14H,2,5,7,9-12H2,1H3,(H,23,24)/b22-18-/t14-/m0/s1 |
| InChIKey | VEDQODZMTSMUOW-RJHYDAJSSA-N |
| XLogP | 4.73 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|