C18H22N2OS — CID 129431639
(5R)-N-[[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 129431639) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (5R)-N-[[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-N-[[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 129431639 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (5R)-N-[[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@@H]1CCc2sc(C(=O)NN=C3C[C@H]4C=CC[C@@H]34)cc2C1 |
| InChI | InChI=1S/C18H22N2OS/c1-2-11-6-7-16-13(8-11)10-17(22-16)18(21)20-19-15-9-12-4-3-5-14(12)15/h3-4,10-12,14H,2,5-9H2,1H3,(H,20,21)/t11-,12-,14-/m1/s1 |
| InChIKey | SNZHWWZLMIUGKD-YRGRVCCFSA-N |
| XLogP | 3.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|